Material: Mateiral editor UI fixes

- Fixed color buttons
- Introduced "Section Color" property
- Fixed named properties
- Added preview icons
- Remember UI dimensions and expanded states

src/Mod/Arch/ArchMaterial.py

@@ -516,16 +516,17 @@ class _ArchMaterialTaskPanel:
         self.existingmaterials = []
         self.obj = obj
         self.form = FreeCADGui.PySideUic.loadUi(":/ui/ArchMaterial.ui")
-        self.color = QtGui.QColor(128,128,128)
         colorPix = QtGui.QPixmap(16,16)
-        colorPix.fill(self.color)
+        colorPix.fill(QtGui.QColor(204,204,204))
         self.form.ButtonColor.setIcon(QtGui.QIcon(colorPix))
+        self.form.ButtonSectionColor.setIcon(QtGui.QIcon(colorPix))
         self.form.ButtonUrl.setIcon(QtGui.QIcon(":/icons/internet-web-browser.svg"))
         QtCore.QObject.connect(self.form.comboBox_MaterialsInDir, QtCore.SIGNAL("currentIndexChanged(QString)"), self.chooseMat)
         QtCore.QObject.connect(self.form.comboBox_FromExisting, QtCore.SIGNAL("currentIndexChanged(int)"), self.fromExisting)
         QtCore.QObject.connect(self.form.comboFather, QtCore.SIGNAL("currentIndexChanged(QString)"), self.setFather)
         QtCore.QObject.connect(self.form.comboFather, QtCore.SIGNAL("currentTextChanged(QString)"), self.setFather)
         QtCore.QObject.connect(self.form.ButtonColor,QtCore.SIGNAL("pressed()"),self.getColor)
+        QtCore.QObject.connect(self.form.ButtonSectionColor,QtCore.SIGNAL("pressed()"),self.getSectionColor)
         QtCore.QObject.connect(self.form.ButtonUrl,QtCore.SIGNAL("pressed()"),self.openUrl)
         QtCore.QObject.connect(self.form.ButtonEditor,QtCore.SIGNAL("pressed()"),self.openEditor)
         QtCore.QObject.connect(self.form.ButtonCode,QtCore.SIGNAL("pressed()"),self.getCode)
@@ -551,21 +552,14 @@ class _ArchMaterialTaskPanel:
             self.form.FieldName.setText(self.obj.Label)
         if 'Description' in self.material:
             self.form.FieldDescription.setText(self.material['Description'])
-        col = None
         if 'DiffuseColor' in self.material:
-            col = self.material["DiffuseColor"]
+            self.form.ButtonColor.setIcon(self.getColorIcon(self.material["DiffuseColor"]))
         elif 'ViewColor' in self.material:
-            col = self.material["ViewColor"]
+            self.form.ButtonColor.setIcon(self.getColorIcon(self.material["ViewColor"]))
         elif 'Color' in self.material:
-            col = self.material["Color"]
-        if col:
-            if "(" in col:
-                c = tuple([float(f) for f in col.strip("()").split(",")])
-                self.color = QtGui.QColor()
-                self.color.setRgbF(c[0],c[1],c[2])
-                colorPix = QtGui.QPixmap(16,16)
-                colorPix.fill(self.color)
-                self.form.ButtonColor.setIcon(QtGui.QIcon(colorPix))
+            self.form.ButtonColor.setIcon(self.getColorIcon(self.material["Color"]))
+        if 'SectionColor' in self.material:
+            self.form.ButtonSectionColor.setIcon(self.getColorIcon(self.material["SectionColor"]))
         if 'StandardCode' in self.material:
             self.form.FieldCode.setText(self.material['StandardCode'])
         if 'ProductURL' in self.material:
@@ -589,18 +583,35 @@ class _ArchMaterialTaskPanel:
             self.form.comboFather.addItem(father)
             self.form.comboFather.setCurrentIndex(self.form.comboFather.count()-1)
 
+    def getColorIcon(self,color):
+        if color:
+            if "(" in color:
+                c = tuple([float(f) for f in color.strip("()").split(",")])
+                qcolor = QtGui.QColor()
+                qcolor.setRgbF(c[0],c[1],c[2])
+                colorPix = QtGui.QPixmap(16,16)
+                colorPix.fill(qcolor)
+                icon = QtGui.QIcon(colorPix)
+                return icon
+        return QtGui.QIcon()
 
     def getFields(self):
         "sets self.material from the contents of the task box"
         self.material['Name'] = self.form.FieldName.text()
         self.material['Description'] = self.form.FieldDescription.text()
-        self.material['DiffuseColor'] = str(self.color.getRgbF()[:3])
+        self.material['DiffuseColor'] = self.getColorFromIcon(self.form.ButtonColor.icon())
         self.material['ViewColor'] = self.material['DiffuseColor']
         self.material['Color'] = self.material['DiffuseColor']
+        self.material['SectionColor'] = self.getColorFromIcon(self.form.ButtonSectionColor.icon())
         self.material['StandardCode'] = self.form.FieldCode.text()
         self.material['ProductURL'] = self.form.FieldUrl.text()
         self.material['Transparency'] = str(self.form.SpinBox_Transparency.value())
 
+    def getColorFromIcon(self,icon):
+        "gets pixel color from the given icon"
+        pixel = icon.pixmap(16,16).toImage().pixel(0,0)
+        return str(QtGui.QColor(pixel).getRgbF())
+
     def accept(self):
         self.getFields()
         if self.obj:
@@ -635,11 +646,18 @@ class _ArchMaterialTaskPanel:
 
     def getColor(self):
         "opens a color picker dialog"
-        self.color = QtGui.QColorDialog.getColor()
+        color = QtGui.QColorDialog.getColor()
         colorPix = QtGui.QPixmap(16,16)
-        colorPix.fill(self.color)
+        colorPix.fill(color)
         self.form.ButtonColor.setIcon(QtGui.QIcon(colorPix))
 
+    def getSectionColor(self):
+        "opens a color picker dialog"
+        color = QtGui.QColorDialog.getColor()
+        colorPix = QtGui.QPixmap(16,16)
+        colorPix.fill(color)
+        self.form.ButtonSectionColor.setIcon(QtGui.QIcon(colorPix))
+
     def fillMaterialCombo(self):
         "fills the combo with the existing FCMat cards"
         # look for cards in both resources dir and a Materials sub-folder in the user folder.

src/Mod/Arch/Resources/ui/ArchMaterial.ui

@@ -131,6 +131,30 @@
      </item>
     </layout>
    </item>
+   <item>
+    <layout class="QHBoxLayout" name="horizontalLayout_7">
+     <item>
+      <widget class="QLabel" name="label_8">
+       <property name="text">
+        <string>Section Color</string>
+       </property>
+      </widget>
+     </item>
+     <item>
+      <widget class="QPushButton" name="ButtonSectionColor">
+       <property name="maximumSize">
+        <size>
+         <width>30</width>
+         <height>16777215</height>
+        </size>
+       </property>
+       <property name="text">
+        <string/>
+       </property>
+      </widget>
+     </item>
+    </layout>
+   </item>
    <item>
     <layout class="QHBoxLayout" name="horizontalLayout_8">
      <item>

src/Mod/Material/MaterialEditor.py

@@ -26,11 +26,11 @@ __url__ = "http://www.freecadweb.org"
 
 import os
 import sys
-from PySide import QtCore, QtGui
-# from PySide import QtUiTools, QtSvg
+from PySide import QtCore, QtGui, QtSvg
 
 import FreeCAD
 import FreeCADGui
+import Material_rc
 
 # is this still needed after the move to card utils???
 if sys.version_info.major >= 3:
@@ -61,6 +61,14 @@ class MaterialEditor:
             os.path.dirname(__file__) + os.sep + "materials-editor.ui"
         )
 
+        self.widget.setWindowIcon(QtGui.QIcon(":/icons/preview-rendered.svg"))
+
+        # restore size and position
+        p = FreeCAD.ParamGet("User parameter:BaseApp/Preferences/Mod/Material")
+        w = p.GetInt("MaterialEditorWidth",441)
+        h = p.GetInt("MaterialEditorHeight",626)
+        self.widget.resize(w,h)
+
         # additional UI fixes and tweaks
         widget = self.widget
         buttonURL = widget.ButtonURL
@@ -72,9 +80,17 @@ class MaterialEditor:
         comboMaterial = widget.ComboMaterial
         treeView = widget.treeView
 
-        # temporarily hide preview fields, as they are not used yet
-        # TODO : implement previews
-        widget.PreviewGroup.hide()
+
+        # create preview svg slots
+        self.widget.PreviewRender = QtSvg.QSvgWidget(":/icons/preview-rendered.svg")
+        self.widget.PreviewRender.setMaximumWidth(64)
+        self.widget.PreviewRender.setMinimumHeight(64)
+        self.widget.topLayout.addWidget(self.widget.PreviewRender)
+        self.widget.PreviewVector = QtSvg.QSvgWidget(":/icons/preview-vector.svg")
+        self.widget.PreviewVector.setMaximumWidth(64)
+        self.widget.PreviewVector.setMinimumHeight(64)
+        self.widget.topLayout.addWidget(self.widget.PreviewVector)
+        self.updatePreviews(mat=material)
 
         buttonURL.setIcon(QtGui.QIcon(":/icons/internet-web-browser.svg"))
         buttonDeleteProperty.setEnabled(False)
@@ -92,7 +108,7 @@ class MaterialEditor:
         comboMaterial.currentIndexChanged[int].connect(self.chooseMaterial)
         buttonAddProperty.clicked.connect(self.addCustomProperty)
         buttonDeleteProperty.clicked.connect(self.deleteCustomProperty)
-        treeView.clicked.connect(self.checkDeletable)
+        treeView.clicked.connect(self.onClickTree)
 
         model = QtGui.QStandardItemModel()
         treeView.setModel(model)
@@ -126,6 +142,7 @@ class MaterialEditor:
 
         '''implements the model with the material attribute structure.'''
 
+        p = FreeCAD.ParamGet("User parameter:BaseApp/Preferences/Mod/Material")
         widget = self.widget
         treeView = widget.treeView
         model = treeView.model()
@@ -147,18 +164,20 @@ class MaterialEditor:
             for properName in group[gg]:
                 pp = properName  # property name
                 item = QtGui.QStandardItem(pp)
+                item.setToolTip(group[gg][properName]['Description'])
                 self.internalprops.append(pp)
 
                 it = QtGui.QStandardItem()
+                it.setToolTip(group[gg][properName]['Description'])
 
                 tt = group[gg][properName]['Type']
                 itType = QtGui.QStandardItem(tt)
 
                 top.appendRow([item, it, itType])
+                treeView.setExpanded(top.index(),p.GetBool("TreeExpand"+gg,True))
+            #top.sortChildren(0)
 
-            top.sortChildren(0)
-
-        treeView.expandAll()
+        #treeView.expandAll()
 
     def updateMatParamsInTree(self, data):
 
@@ -181,6 +200,11 @@ class MaterialEditor:
                     it.setText(value)
                     del data[kk]
                 except KeyError:
+                    # treat here changes in Material Card Template
+                    # Norm -> StandardCode
+                    if (kk == "Standard Code") and ("Norm" in data) and data["Norm"]:
+                        it.setText(data["Norm"])
+                        del data["Norm"]
                     it.setText("")
 
         userGroup = root.child(gg + 1, 0)
@@ -195,6 +219,7 @@ class MaterialEditor:
             self.customprops.append(k)
 
     def chooseMaterial(self, index):
+
         if index < 0:
             return
         self.card_path = self.widget.ComboMaterial.itemData(index)
@@ -256,13 +281,26 @@ class MaterialEditor:
     def accept(self):
         ""
 
+        self.storeSize()
         QtGui.QDialog.accept(self.widget)
 
     def reject(self):
         ""
 
+        self.storeSize()
         QtGui.QDialog.reject(self.widget)
 
+    def storeSize(self):
+        "stores the widget size"
+        # store widths
+        p = FreeCAD.ParamGet("User parameter:BaseApp/Preferences/Mod/Material")
+        p.SetInt("MaterialEditorWidth",self.widget.width())
+        p.SetInt("MaterialEditorHeight",self.widget.height())
+        root = self.widget.treeView.model().invisibleRootItem()
+        for gg in range(root.rowCount()):
+            group = root.child(gg)
+            p.SetBool("TreeExpand"+group.text(),self.widget.treeView.isExpanded(group.index()))
+
     def expandKey(self, key):
         "adds spaces before caps in a KeyName"
         nk = ""
@@ -338,7 +376,7 @@ class MaterialEditor:
 
         buttonDeleteProperty.setEnabled(False)
 
-    def checkDeletable(self, index):
+    def onClickTree(self, index):
 
         '''Checks if the current item is a custom or an internal property,
         and enable the delete property or delete value button.'''
@@ -370,6 +408,8 @@ class MaterialEditor:
             buttonDeleteProperty.setEnabled(False)
             buttonDeleteProperty.setProperty("text", "Delete property")
 
+        self.updatePreviews()
+
     def getDict(self):
         "returns a dictionary from the contents of the editor."
 
@@ -414,6 +454,52 @@ class MaterialEditor:
                     self.widget.PreviewVector.show()
     '''
 
+    def updatePreviews(self,mat=None):
+        "updates the preview images from the content of the editor"
+        if not mat:
+            mat = self.getDict()
+        diffcol = None
+        highlightcol = None
+        sectioncol = None
+        if "DiffuseColor" in mat:
+            diffcol = mat["DiffuseColor"]
+        elif "ViewColor" in mat:
+            diffcol = mat["ViwColor"]
+        elif "Color" in mat:
+            diffcol = mat["Color"]
+        if "SpecularColor" in mat:
+            highlightcol = mat["SpecularColor"]
+        if "SectionColor" in mat:
+            sectioncol = mat["SectionColor"]
+        if diffcol or highlightcol:
+            fd = QtCore.QFile(":/icons/preview-rendered.svg")
+            if fd.open(QtCore.QIODevice.ReadOnly | QtCore.QIODevice.Text):
+                svg = QtCore.QTextStream(fd).readAll()
+                fd.close()
+                if diffcol:
+                    svg = svg.replace("#d3d7cf",self.getColorHash(diffcol,val=255))
+                    svg = svg.replace("#555753",self.getColorHash(diffcol,val=125))
+                if highlightcol:
+                    svg = svg.replace("#fffffe",self.getColorHash(highlightcol,val=255))
+                self.widget.PreviewRender.load(QtCore.QByteArray(bytes(svg,encoding="utf8")))
+        if diffcol or sectioncol:
+            fd = QtCore.QFile(":/icons/preview-vector.svg")
+            if fd.open(QtCore.QIODevice.ReadOnly | QtCore.QIODevice.Text):
+                svg = QtCore.QTextStream(fd).readAll()
+                fd.close()
+                if diffcol:
+                    svg = svg.replace("#d3d7cf",self.getColorHash(diffcol,val=255))
+                    svg = svg.replace("#555753",self.getColorHash(diffcol,val=125))
+                if sectioncol:
+                    svg = svg.replace("#ffffff",self.getColorHash(sectioncol,val=255))
+                self.widget.PreviewVector.load(QtCore.QByteArray(bytes(svg,encoding="utf8")))
+
+    def getColorHash(self,col,val=255):
+        "returns a '#000000' string from a '(0.1,0.2,0.3)' string"
+        col = [float(x.strip()) for x in col.strip("()").split(",")]
+        color = QtGui.QColor(int(col[0]*val),int(col[1]*val),int(col[2]*val))
+        return color.name()
+
     def openfile(self):
         "Opens a FCMat file"
         filetuple = QtGui.QFileDialog.getOpenFileName(
@@ -550,7 +636,7 @@ class MaterialsDelegate(QtGui.QStyledItemDelegate):
         if Type == "Color":
 
             color = editor.property('color')
-            color = color.getRgb()
+            color = tuple([v/255.0 for v in color.getRgb()])
             item.setText(str(color))
 
         elif Type == "File":
@@ -650,7 +736,7 @@ def string2tuple(string):
     "provisionally"
     value = string[1:-1]
     value = value.split(',')
-    value = [int(v) for v in value]
+    value = [int(float(v)*255) for v in value]
     value = tuple(value)
     return value
 

src/Mod/Material/Resources/icons/preview-vector.svg

@@ -134,7 +134,7 @@
          inkscape:connector-curvature="0"
          sodipodi:nodetypes="ccccc" />
       <path
-         style="fill:#babdb6;stroke:#d3d7cf;stroke-width:2;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1"
+         style="fill:#555753;stroke:#555753;stroke-width:2;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1"
          d="M 59.035745,9.6627807 59.108006,34.818961 40.91531,54.264958 42.698526,19.372964 z"
          id="path3022"
          inkscape:connector-curvature="0"

src/Mod/Material/Templatematerial.yml

@@ -39,56 +39,52 @@
     CardName:  # first in group
       Type: 'String'
       URL: ''
-      Description: " "
+      Description: "This is the name under which this material should be saved as a file"
     AuthorAndLicense:
       Type: 'String'
       URL: ''
-      Description: " "
+      Description: "Optional author name and license information"
 - General:
     Name:  # first in group
       Type: 'String'
       URL: ''
       Description: "General name"  # used to be equal with card name, TODO: should all cards be changed back to this?
-    NameDE:
-      Type: 'String'
-      URL: ''
-      Description: "German localized name"
-    NamePL:
-      Type: 'String'
-      URL: ''
-      Description: "Polish localized name"
+#    NameDE:
+#      Type: 'String'
+#      URL: ''
+#      Description: "German localized name"
+#    NamePL:
+#      Type: 'String'
+#      URL: ''
+#      Description: "Polish localized name"
     Description:
       Type: 'String'
       URL: ''
       Description: "A more elaborate description of the material"
-    DescriptionDE:
-      Type: 'String'
-      URL: ''
-      Description: "German localized description"
-    DescriptionPL:
-      Type: 'String'
-      URL: ''
-      Description: "Polish localized description"
+#    DescriptionDE:
+#      Type: 'String'
+#      URL: ''
+#      Description: "German localized description"
+#    DescriptionPL:
+#      Type: 'String'
+#      URL: ''
+#      Description: "Polish localized description"
     Father:
       Type: 'String'
       URL: ''
-      Description: "Father of the material, i.e. for PLA is Thermoplast, for Steel is Metal"
+      Description: "Father of the material, ex. the father of PLA is Thermoplast, the father of Steel is Metal"
     KindOfMaterial:
       Type: 'String'
       URL: ''
       Description: " "
-    KindOfMaterialDE:
-      Type: 'String'
-      URL: ''
-      Description: "Germand localized kind of material"
+#    KindOfMaterialDE:
+#      Type: 'String'
+#      URL: ''
+#      Description: "Germand localized kind of material"
     MaterialNumber:
       Type: 'String'
       URL: ''
       Description: " "
-    Norm:  # should be merged with StandardCode
-      Type: 'String'
-      URL: ''
-      Description: " "
     ReferenceSource:
       Type: 'String'
       URL: ''
@@ -100,7 +96,7 @@
     StandardCode:
       Type: 'String'
       URL: ''
-      Description: " "
+      Description: "This is a reference to a norm or standards system where this material is referenced by a precise ID or number"
 - Mechanical:
     AngleOfFriction:
       Type: 'Quantity'
@@ -245,6 +241,10 @@
       Type: 'Float'
       URL: ''
       Description: " "
+    SectionColor:
+      Type: 'Color'
+      URL: ''
+      Description: " "
     ViewColor:
       Type: 'Color'
       URL: ''

src/Mod/Material/materials-editor.ui

@@ -23,110 +23,70 @@
        </property>
        <layout class="QVBoxLayout" name="verticalLayout_4">
         <item>
-         <layout class="QHBoxLayout" name="horizontalLayout_7">
+         <layout class="QHBoxLayout" name="topLayout">
           <item>
-           <widget class="QPushButton" name="ButtonURL">
-            <property name="maximumSize">
-             <size>
-              <width>22</width>
-              <height>22</height>
-             </size>
-            </property>
-            <property name="toolTip">
-             <string>Opens the Product URL of this material in an external browser</string>
-            </property>
-            <property name="text">
-             <string/>
-            </property>
-           </widget>
-          </item>
-          <item>
-           <widget class="QComboBox" name="ComboMaterial">
-            <property name="minimumSize">
-             <size>
-              <width>120</width>
-              <height>0</height>
-             </size>
-            </property>
-            <property name="toolTip">
-             <string>Existing material cards</string>
-            </property>
-           </widget>
+           <layout class="QVBoxLayout" name="verticalLayout_6">
+            <item>
+             <layout class="QHBoxLayout" name="horizontalLayout_7">
+              <item>
+               <widget class="QPushButton" name="ButtonURL">
+                <property name="maximumSize">
+                 <size>
+                  <width>22</width>
+                  <height>22</height>
+                 </size>
+                </property>
+                <property name="toolTip">
+                 <string>Opens the Product URL of this material in an external browser</string>
+                </property>
+                <property name="text">
+                 <string/>
+                </property>
+               </widget>
+              </item>
+              <item>
+               <widget class="QComboBox" name="ComboMaterial">
+                <property name="minimumSize">
+                 <size>
+                  <width>120</width>
+                  <height>0</height>
+                 </size>
+                </property>
+                <property name="toolTip">
+                 <string>Existing material cards</string>
+                </property>
+               </widget>
+              </item>
+             </layout>
+            </item>
+            <item>
+             <layout class="QHBoxLayout" name="horizontalLayout">
+              <item>
+               <widget class="QPushButton" name="ButtonOpen">
+                <property name="toolTip">
+                 <string>Opens an existing material card</string>
+                </property>
+                <property name="text">
+                 <string>Open...</string>
+                </property>
+               </widget>
+              </item>
+              <item>
+               <widget class="QPushButton" name="ButtonSave">
+                <property name="toolTip">
+                 <string>Saves this material as a card</string>
+                </property>
+                <property name="text">
+                 <string>Save as...</string>
+                </property>
+               </widget>
+              </item>
+             </layout>
+            </item>
+           </layout>
           </item>
          </layout>
         </item>
-        <item>
-         <layout class="QHBoxLayout" name="horizontalLayout">
-          <item>
-           <widget class="QPushButton" name="ButtonOpen">
-            <property name="toolTip">
-             <string>Opens an existing material card</string>
-            </property>
-            <property name="text">
-             <string>Open...</string>
-            </property>
-           </widget>
-          </item>
-          <item>
-           <widget class="QPushButton" name="ButtonSave">
-            <property name="toolTip">
-             <string>Saves this material as a card</string>
-            </property>
-            <property name="text">
-             <string>Save as...</string>
-            </property>
-           </widget>
-          </item>
-         </layout>
-        </item>
-       </layout>
-      </widget>
-     </item>
-     <item>
-      <widget class="QGroupBox" name="PreviewGroup">
-       <property name="title">
-        <string>Preview</string>
-       </property>
-       <layout class="QHBoxLayout" name="horizontalLayout_2">
-        <item>
-         <spacer name="horizontalSpacer_3">
-          <property name="orientation">
-           <enum>Qt::Horizontal</enum>
-          </property>
-          <property name="sizeHint" stdset="0">
-           <size>
-            <width>40</width>
-            <height>20</height>
-           </size>
-          </property>
-         </spacer>
-        </item>
-        <item>
-         <widget class="QLabel" name="PreviewRender">
-          <property name="minimumSize">
-           <size>
-            <width>96</width>
-            <height>96</height>
-           </size>
-          </property>
-          <property name="text">
-           <string/>
-          </property>
-         </widget>
-        </item>
-        <item>
-         <widget class="QLabel" name="PreviewVector">
-          <property name="minimumSize">
-           <size>
-            <width>96</width>
-            <height>96</height>
-           </size>
-          </property>
-          <property name="text">
-           <string/>
-          </property>
-         </widget>
-        </item>
        </layout>
       </widget>
      </item>

src/Mod/Material/materialtools/cardutils.py

@@ -99,11 +99,12 @@ def get_material_resources(category='Solid'):
         custom_mat_dir = mat_prefs.GetString("CustomMaterialsDir", "")
         if os.path.exists(custom_mat_dir):
             resources[custom_mat_dir] = ":/icons/user.svg"
-        else:
-            FreeCAD.Console.PrintError(
-                'Custom material directory set by user: {} does not exist.\n'
-                .format(custom_mat_dir)
-            )
+        # fail silently
+        #else:
+        #    FreeCAD.Console.PrintError(
+        #        'Custom material directory set by user: {} does not exist.\n'
+        #        .format(custom_mat_dir)
+        #    )
 
     return resources
 
@@ -229,14 +230,18 @@ def get_material_template(withSpaces=False):
         # on attributes, add a space before a capital letter
         # will be used for better display in the ui
         import re
+        new_template = []
         for group in template_data:
+            new_group = {}
             gg = list(group.keys())[0]  # group dict has only one key
             # iterating over a dict and changing it is not allowed
             # thus it is iterated over a list of the keys
+            new_group[gg] = {}
             for proper in list(group[gg].keys()):
                 new_proper = re.sub(r"(\w)([A-Z]+)", r"\1 \2", proper)
-                group[gg][new_proper] = group[gg][proper]
-                del group[gg][proper]
+                new_group[gg][new_proper] = group[gg][proper]
+            new_template.append(new_group)
+        template_data = new_template
     return template_data